EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H38N6O10 |
| Net Charge | 0 |
| Average Mass | 678.699 |
| Monoisotopic Mass | 678.26494 |
| SMILES | C/C=C\NC(=O)[C@H]1NC(=O)[C@@H](CC(N)=O)NC(=O)[C@@H](NC(=O)C(=O)[C@@H](C)CC)Cc2ccc(O)c(c2)-c2cccc3c2NC(=O)[C@@]3(O)[C@@H]1O |
| InChI | InChI=1S/C33H38N6O10/c1-4-11-35-30(46)25-27(43)33(49)19-8-6-7-17(24(19)39-32(33)48)18-12-16(9-10-22(18)40)13-20(37-31(47)26(42)15(3)5-2)28(44)36-21(14-23(34)41)29(45)38-25/h4,6-12,15,20-21,25,27,40,43,49H,5,13-14H2,1-3H3,(H2,34,41)(H,35,46)(H,36,44)(H,37,47)(H,38,45)(H,39,48)/b11-4-/t15-,20-,21+,25-,27+,33-/m0/s1 |
| InChIKey | ZIAXNZCTODBCKW-QNKLOUHTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Apiospora (ncbitaxon:1811811) | - | PubMed (10805568) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| TMC-95 C (CHEBI:197853) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (10S,11R,12S,15R,18S)-15-(2-amino-2-oxoethyl)-10,11,23-trihydroxy-18-[[(3S)-3-methyl-2-oxopentanoyl]amino]-9,14,17-trioxo-N-[(Z)-prop-1-enyl]-8,13,16-triazatetracyclo[18.3.1.02,7.06,10]tetracosa-1(23),2(7),3,5,20(24),21-hexaene-12-carboxamide |
| Manual Xrefs | Databases |
|---|---|
| 58985581 | ChemSpider |