EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H50N8O9 |
| Net Charge | 0 |
| Average Mass | 786.887 |
| Monoisotopic Mass | 786.37008 |
| SMILES | NC(N)=NCCC[C@@H](NC(=O)C[C@H](O)[C@@H](Cc1cnc2ccccc12)NC(=O)CCNC(=O)[C@H](O)Cc1ccccc1)C(=O)N[C@@H](C(=O)O)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C40H50N8O9/c41-40(42)44-18-9-16-29(37(54)48-35(39(56)57)36(53)25-12-5-2-6-13-25)46-34(52)22-31(49)30(21-26-23-45-28-15-8-7-14-27(26)28)47-33(51)17-19-43-38(55)32(50)20-24-10-3-1-4-11-24/h1-8,10-15,23,29-32,35-36,45,49-50,53H,9,16-22H2,(H,43,55)(H,46,52)(H,47,51)(H,48,54)(H,56,57)(H4,41,42,44)/t29-,30-,31+,32-,35-,36-/m1/s1 |
| InChIKey | WUXSZVRSSSITPJ-LHXUXNRLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Microcystis aeruginosa NIES-87 (ncbitaxon:449440) | - | PubMed (10987919) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Kasumigamide (CHEBI:197849) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2R,3R)-2-[[(2R)-5-(diaminomethylideneamino)-2-[[(3S,4R)-3-hydroxy-4-[3-[[(2R)-2-hydroxy-3-phenylpropanoyl]amino]propanoylamino]-5-(1H-indol-3-yl)pentanoyl]amino]pentanoyl]amino]-3-hydroxy-3-phenylpropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 8756497 | ChemSpider |