EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H38N4O6 |
| Net Charge | 0 |
| Average Mass | 526.634 |
| Monoisotopic Mass | 526.27913 |
| SMILES | CC(C)[C@H](NC(=O)[C@H](N)Cc1ccccc1)C(=O)N[C@@H](C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O)C(C)C |
| InChI | InChI=1S/C28H38N4O6/c1-16(2)23(26(35)30-22(28(37)38)15-19-10-12-20(33)13-11-19)32-27(36)24(17(3)4)31-25(34)21(29)14-18-8-6-5-7-9-18/h5-13,16-17,21-24,33H,14-15,29H2,1-4H3,(H,30,35)(H,31,34)(H,32,36)(H,37,38)/t21-,22+,23-,24+/m1/s1 |
| InChIKey | LUVNTPPXXIXEDW-QPXUXIHVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium canescens (ncbitaxon:5083) | - | PubMed (19697335) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-Phe-L-Val-D-Val-L-Tyr (CHEBI:197796) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| (2S)-2-[[(2R)-2-[[(2S)-2-[[(2R)-2-amino-3-phenylpropanoyl]amino]-3-methylbutanoyl]amino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 28286643 | ChemSpider |