EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8Cl2O3 |
| Net Charge | 0 |
| Average Mass | 235.066 |
| Monoisotopic Mass | 233.98505 |
| SMILES | COC(=O)c1cc(Cl)c(OC)c(Cl)c1 |
| InChI | InChI=1S/C9H8Cl2O3/c1-13-8-6(10)3-5(4-7(8)11)9(12)14-2/h3-4H,1-2H3 |
| InChIKey | SHPKLAWJDWHSCJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bjerkandera (ncbitaxon:5330) | - | DOI (10.1016/0031-9422(96)00191-4) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl 3,5-dichloro-4-methoxybenzoate (CHEBI:197754) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| methyl 3,5-dichloro-4-methoxybenzoate |
| Manual Xrefs | Databases |
|---|---|
| 29932 | ChemSpider |