EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H52N4O9 |
| Net Charge | 0 |
| Average Mass | 708.853 |
| Monoisotopic Mass | 708.37343 |
| SMILES | CC[C@H](C)[C@@H](C(=O)N[C@@H](Cc1ccc(OCC=C(C)C)cc1)C(=O)O)N(C)C(=O)[C@H](CO)NC(=O)[C@@H]1CCCN1C(=O)C(O)Cc1ccccc1 |
| InChI | InChI=1S/C38H52N4O9/c1-6-25(4)33(35(46)39-29(38(49)50)21-27-14-16-28(17-15-27)51-20-18-24(2)3)41(5)36(47)30(23-43)40-34(45)31-13-10-19-42(31)37(48)32(44)22-26-11-8-7-9-12-26/h7-9,11-12,14-18,25,29-33,43-44H,6,10,13,19-23H2,1-5H3,(H,39,46)(H,40,45)(H,49,50)/t25-,29-,30-,31-,32?,33-/m0/s1 |
| InChIKey | HGRKCBGERCWAPT-AJLYFVEGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Clonostachys rosea (ncbitaxon:29856) | - | PubMed (22822358) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pullularin F (CHEBI:197736) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-2-[[(2S,3S)-2-[[(2S)-3-hydroxy-2-[[(2S)-1-(2-hydroxy-3-phenylpropanoyl)pyrrolidine-2-carbonyl]amino]propanoyl]-methylamino]-3-methylpentanoyl]amino]-3-[4-(3-methylbut-2-enoxy)phenyl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 29214595 | ChemSpider |