EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H16O7 |
| Net Charge | 0 |
| Average Mass | 368.341 |
| Monoisotopic Mass | 368.08960 |
| SMILES | CC1=C(C(=O)O)C(=O)C2c3cc4cccc(O)c4c(O)c3C(=O)CC2(O)C1 |
| InChI | InChI=1S/C20H16O7/c1-8-6-20(27)7-12(22)15-10(16(20)18(24)13(8)19(25)26)5-9-3-2-4-11(21)14(9)17(15)23/h2-5,16,21,23,27H,6-7H2,1H3,(H,25,26) |
| InChIKey | HZZQUBYOXIKCPW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces albus (ncbitaxon:1888) | - | PubMed (18988223) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Prejadomycin 2-carboxylate (CHEBI:197719) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| 4a,7,8-trihydroxy-3-methyl-1,6-dioxo-5,12b-dihydro-4H-benzo[a]anthracene-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 78435920 | ChemSpider |