EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H48O7 |
| Net Charge | 0 |
| Average Mass | 568.751 |
| Monoisotopic Mass | 568.34000 |
| SMILES | CC1=C(C)[C@]2(C[C@@H](C)[C@H]3[C@@H](C[C@@]4(C)C5=C(CC[C@]34C)[C@@]3(C)CC[C@@H](OC(=O)CC(=O)O)C(C)(C)[C@@H]3CC5)O2)OC1=O |
| InChI | InChI=1S/C34H48O7/c1-18-16-34(20(3)19(2)29(38)41-34)40-23-17-33(8)22-9-10-24-30(4,5)25(39-27(37)15-26(35)36)12-13-31(24,6)21(22)11-14-32(33,7)28(18)23/h18,23-25,28H,9-17H2,1-8H3,(H,35,36)/t18-,23-,24+,25-,28+,31-,32-,33+,34+/m1/s1 |
| InChIKey | OKJOASLJZNAUJH-FWVAHMOUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hexagonia tenuis (ncbitaxon:252822) | - | DOI (10.1016/j.tet.2014.09.013) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hexatenuin A (CHEBI:197716) is a withanolide (CHEBI:74716) |
| IUPAC Name |
|---|
| 3-[(2R,4R,6S,8R,9R,10R,14S,17R,19R)-2,3',4',8,10,14,18,18-octamethyl-5'-oxospiro[5-oxapentacyclo[11.8.0.02,10.04,9.014,19]henicos-1(13)-ene-6,2'-uran]-17-yl]oxy-3-oxopropanoic acid |