EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H16O7 |
| Net Charge | 0 |
| Average Mass | 368.341 |
| Monoisotopic Mass | 368.08960 |
| SMILES | O=C1C[C@H](O)[C@H]2c3ccc(O)c4c3[C@](O)(c3ccc(O)c1c32)[C@@H](O)CC4=O |
| InChI | InChI=1S/C20H16O7/c21-9-4-2-8-16-15(11(23)5-12(24)17(9)16)7-1-3-10(22)18-13(25)6-14(26)20(8,27)19(7)18/h1-4,11,14-15,21-23,26-27H,5-6H2/t11-,14-,15+,20-/m0/s1 |
| InChIKey | VJWXYPUJILLMFB-GSLSEBINSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alternaria (ncbitaxon:5598) | - | DOI (10.1016/j.tetlet.2016.06.035) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,4,6b,7,10-pentahydroxy-1,2,6b,7,8,12b-hexahydroperylene-3,9-dione (CHEBI:197698) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (1S,6bS,7S,12bR)-1,4,7,10,12b-pentahydroxy-2,6b,7,8-tetrahydro-1H-perylene-3,9-dione |
| Manual Xrefs | Databases |
|---|---|
| 78442436 | ChemSpider |