EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H21N3O3 |
| Net Charge | 0 |
| Average Mass | 303.362 |
| Monoisotopic Mass | 303.15829 |
| SMILES | N[C@@H](CCCCNC(=O)Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C16H21N3O3/c17-13(16(21)22)6-3-4-8-18-15(20)9-11-10-19-14-7-2-1-5-12(11)14/h1-2,5,7,10,13,19H,3-4,6,8-9,17H2,(H,18,20)(H,21,22)/t13-/m0/s1 |
| InChIKey | FKIGOUKDKBOZID-ZDUSSCGKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas savastanoi (ncbitaxon:29438) | - | PubMed (5644130) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Indole-3-acetyl-epsilon-L-lysine (CHEBI:197665) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2-amino-6-[[2-(1H-indol-3-yl)acetyl]amino]hexanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 2590971 | ChemSpider |