EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O6 |
| Net Charge | 0 |
| Average Mass | 302.282 |
| Monoisotopic Mass | 302.07904 |
| SMILES | COc1cc(O)c2c(c1)C(=O)C1=C(C2=O)[C@@H](OC)OC(C)=C1 |
| InChI | InChI=1S/C16H14O6/c1-7-4-9-13(16(21-3)22-7)15(19)12-10(14(9)18)5-8(20-2)6-11(12)17/h4-6,16-17H,1-3H3/t16-/m0/s1 |
| InChIKey | VLFQJYYELRNWFO-INIZCTEOSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ascomycone A (CHEBI:197619) is a benzoisochromanequinone (CHEBI:48129) |
| IUPAC Name |
|---|
| 9-hydroxy-1,7-dimethoxy-3-methyl-1H-benzo[g]isochromene-5,10-dione |
| Manual Xrefs | Databases |
|---|---|
| 24635612 | ChemSpider |