EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H49N9O16 |
| Net Charge | 0 |
| Average Mass | 803.780 |
| Monoisotopic Mass | 803.32973 |
| SMILES | C/C=C(/C)C(=O)NCC1NC(=O)C(C(=O)O)NC(=O)C(O)CNC(=O)C(C(C)O)NC(=O)C(C(O)C(O)C(N)=O)NC(=O)C(C(C)C)NC(=O)C(CO)NC1=O |
| InChI | InChI=1S/C31H49N9O16/c1-6-11(4)23(47)33-7-13-24(48)36-14(9-41)25(49)37-16(10(2)3)28(52)39-18(20(44)21(45)22(32)46)29(53)38-17(12(5)42)27(51)34-8-15(43)26(50)40-19(31(55)56)30(54)35-13/h6,10,12-21,41-45H,7-9H2,1-5H3,(H2,32,46)(H,33,47)(H,34,51)(H,35,54)(H,36,48)(H,37,49)(H,38,53)(H,39,52)(H,40,50)(H,55,56)/b11-6- |
| InChIKey | TYJKJQLKDPSIMY-WDZFZDKYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinomadura (ncbitaxon:1988) | - | PubMed (15152807) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GE23077 A1/A2 (CHEBI:197584) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| 14-(3-amino-1,2-dihydroxy-3-oxopropyl)-21-hydroxy-17-(1-hydroxyethyl)-8-(hydroxymethyl)-5-[[[(Z)-2-methylbut-2-enoyl]amino]methyl]-3,6,9,12,15,18,22-heptaoxo-11-propan-2-yl-1,4,7,10,13,16,19-heptazacyclodocosane-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 8435246 | ChemSpider |