EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H48O |
| Net Charge | 0 |
| Average Mass | 340.636 |
| Monoisotopic Mass | 340.37052 |
| SMILES | CCCCCCCCCCCCCCCCCCCCCC(C)O |
| InChI | InChI=1S/C23H48O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(2)24/h23-24H,3-22H2,1-2H3 |
| InChIKey | JOOHONOKOZUMOT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Evolvulus alsinoides (ncbitaxon:439689) | leaf (BTO:0000713) | PubMed (32345272) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tricosan-2-ol (CHEBI:197529) has role plant metabolite (CHEBI:76924) |
| tricosan-2-ol (CHEBI:197529) is a secondary fatty alcohol (CHEBI:167095) |
| tricosan-2-ol (CHEBI:197529) is a tricosanol (CHEBI:197527) |
| IUPAC Name |
|---|
| tricosan-2-ol |
| Synonyms | Source |
|---|---|
| 2-tricosanol | ChEBI |
| 2-hydroxytricosane | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:39754-77-3 | ChEBI |
| Citations |
|---|