EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H17NO7 |
| Net Charge | 0 |
| Average Mass | 275.257 |
| Monoisotopic Mass | 275.10050 |
| SMILES | [H][C@@]12C[C@](C[C@H](N)C(=O)O)(C(=O)O)O[C@]1([H])[C@H](O)CCO2 |
| InChI | InChI=1S/C11H17NO7/c12-5(9(14)15)3-11(10(16)17)4-7-8(19-11)6(13)1-2-18-7/h5-8,13H,1-4,12H2,(H,14,15)(H,16,17)/t5-,6+,7+,8+,11+/m0/s1 |
| InChIKey | KHYCZTHJICFSLU-XMURUDDGSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | excitatory amino acid agonist An agent that binds to and activates excitatory amino acid receptors. |
| Application: | excitatory amino acid agonist An agent that binds to and activates excitatory amino acid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-deoxyneodysiherbaine A (CHEBI:197524) has role excitatory amino acid agonist (CHEBI:50103) |
| 9-deoxyneodysiherbaine A (CHEBI:197524) is a amino dicarboxylic acid (CHEBI:36164) |
| 9-deoxyneodysiherbaine A (CHEBI:197524) is a furopyran (CHEBI:74927) |
| 9-deoxyneodysiherbaine A (CHEBI:197524) is a hydroxy carboxylic acid (CHEBI:24669) |
| 9-deoxyneodysiherbaine A (CHEBI:197524) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (2R,3aR,7R,7aR)-2-[(2S)-2-amino-2-carboxyethyl]-7-hydroxyhexahydro-2H-furo[3,2-b]pyran-2-carboxylic acid (non-preferred name) |
| Synonyms | Source |
|---|---|
| 9-deoxy-NDH | ChEBI |
| 9-deoxy-neoDH | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 9DX | PDBeChem |
| Citations |
|---|