EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H17NO6 |
| Net Charge | 0 |
| Average Mass | 259.258 |
| Monoisotopic Mass | 259.10559 |
| SMILES | [H][C@@]12C[C@](C[C@H](N)C(=O)O)(C(=O)O)O[C@]1([H])CCCO2 |
| InChI | InChI=1S/C11H17NO6/c12-6(9(13)14)4-11(10(15)16)5-8-7(18-11)2-1-3-17-8/h6-8H,1-5,12H2,(H,13,14)(H,15,16)/t6-,7+,8+,11+/m0/s1 |
| InChIKey | RZIYCCQNKHONBB-PRKAOEEVSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antinociceptive agent Any agent that inhibits nociception. excitatory amino acid antagonist Any substance which inhibits the action of receptors for excitatory amino acids. |
| Application: | antinociceptive agent Any agent that inhibits nociception. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| MSVIII-19 (CHEBI:197522) has role antinociceptive agent (CHEBI:228138) |
| MSVIII-19 (CHEBI:197522) has role excitatory amino acid antagonist (CHEBI:60798) |
| MSVIII-19 (CHEBI:197522) is a amino dicarboxylic acid (CHEBI:36164) |
| MSVIII-19 (CHEBI:197522) is a furopyran (CHEBI:74927) |
| IUPAC Name |
|---|
| (2R,3aR,7aR)-2-[(2S)-2-amino-2-carboxyethyl]hexahydro-2H-furo[3,2-b]pyran-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| 2-amino-4,7:6,10-dianhydro-4-carboxy-2,3,5,8,9-pentadeoxy-D-talo-deconic acid | IUPAC |
| 8,9-dideoxy-NDH | ChEBI |
| 8,9-dideoxyneodysiherbaine | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| MS8 | PDBeChem |
| Citations |
|---|