EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H46O |
| Net Charge | 0 |
| Average Mass | 326.609 |
| Monoisotopic Mass | 326.35487 |
| SMILES | CCCCCCCCCCCCC(O)CCCCCCCCC |
| InChI | InChI=1S/C22H46O/c1-3-5-7-9-11-12-13-15-17-19-21-22(23)20-18-16-14-10-8-6-4-2/h22-23H,3-21H2,1-2H3 |
| InChIKey | CXVXDJZIVPZPSN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sibiraea angustata (ncbitaxon:1055022) | - | Article (Liu Jianxiang, Wu Shujun, Wei Xiaoyi, Yang Renzhou. Studies on the chemical constituents of Siniraea Angustata. Journal of Tropical and Subtropical Botany, 1999, 7(3):248-251 (https://europepmc.org/article/CBA/328616).) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| docosan-10-ol (CHEBI:197520) has role plant metabolite (CHEBI:76924) |
| docosan-10-ol (CHEBI:197520) is a docosanol (CHEBI:197511) |
| docosan-10-ol (CHEBI:197520) is a secondary fatty alcohol (CHEBI:167095) |
| IUPAC Name |
|---|
| docosan-10-ol |
| Synonyms | Source |
|---|---|
| 10-docosanol | ChEBI |
| 10-hydroxydocosane | ChEBI |
| Citations |
|---|