EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H42O |
| Net Charge | 0 |
| Average Mass | 298.555 |
| Monoisotopic Mass | 298.32357 |
| SMILES | CCCCCCCCCCC(O)CCCCCCCCC |
| InChI | InChI=1S/C20H42O/c1-3-5-7-9-11-13-15-17-19-20(21)18-16-14-12-10-8-6-4-2/h20-21H,3-19H2,1-2H3 |
| InChIKey | XYQREBYZFVVGCJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nelumbo nucifera (ncbitaxon:4432) | leaf (BTO:0000713) | PubMed (29152009) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| icosan-10-ol (CHEBI:197489) has role plant metabolite (CHEBI:76924) |
| icosan-10-ol (CHEBI:197489) is a icosanol (CHEBI:197480) |
| icosan-10-ol (CHEBI:197489) is a secondary fatty alcohol (CHEBI:167095) |
| IUPAC Name |
|---|
| icosan-10-ol |
| Synonyms | Source |
|---|---|
| 10-eicosanol | ChEBI |
| 10-hydroxyeicosane | ChEBI |
| 10-hydroxyicosane | ChEBI |
| 10-icosanol | ChEBI |
| eicosan-10-ol | ChEBI |
| Citations |
|---|