EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H40O |
| Net Charge | 0 |
| Average Mass | 284.528 |
| Monoisotopic Mass | 284.30792 |
| SMILES | CCCCCCCCCCCCCCCC(O)CCC |
| InChI | InChI=1S/C19H40O/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-18-19(20)17-4-2/h19-20H,3-18H2,1-2H3 |
| InChIKey | JFSDVDBEFPZPRO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pontederia crassipes (ncbitaxon:44947) | whole plant (BTO:0001461) | PubMed (35370709) | Species also known as Eichhornia crassipes. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nonadecan-4-ol (CHEBI:197473) has role plant metabolite (CHEBI:76924) |
| nonadecan-4-ol (CHEBI:197473) is a nonadecanol (CHEBI:197468) |
| nonadecan-4-ol (CHEBI:197473) is a secondary fatty alcohol (CHEBI:167095) |
| IUPAC Name |
|---|
| nonadecan-4-ol |
| Synonyms | Source |
|---|---|
| 4-hydroxynonadecane | ChEBI |
| 4-nonadecanol | ChEBI |
| Citations |
|---|