EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H40O |
| Net Charge | 0 |
| Average Mass | 284.528 |
| Monoisotopic Mass | 284.30792 |
| SMILES | CCCCCCCCCCCCCCCCCC(C)O |
| InChI | InChI=1S/C19H40O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(2)20/h19-20H,3-18H2,1-2H3 |
| InChIKey | QXYWIOWTBOREMG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dryopteris crassirhizoma (ncbitaxon:97234) | - | PubMed (35956948) | |
| Bacillus sp. (ncbitaxon:1409) | - | PubMed (32346353) | Strain: DBS4 |
| Physalis peruviana (ncbitaxon:126903) | - | PubMed (24741358) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nonadecan-2-ol (CHEBI:197471) has role bacterial metabolite (CHEBI:76969) |
| nonadecan-2-ol (CHEBI:197471) has role plant metabolite (CHEBI:76924) |
| nonadecan-2-ol (CHEBI:197471) is a nonadecanol (CHEBI:197468) |
| nonadecan-2-ol (CHEBI:197471) is a secondary fatty alcohol (CHEBI:167095) |
| IUPAC Name |
|---|
| nonadecan-2-ol |
| Synonyms | Source |
|---|---|
| 2-nonadecanol | ChEBI |
| 2-hydroxynonadecane | ChEBI |
| methylheptadecylcarbinol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:26533-36-8 | NIST Chemistry WebBook |
| Citations |
|---|