EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H38O |
| Net Charge | 0 |
| Average Mass | 270.501 |
| Monoisotopic Mass | 270.29227 |
| SMILES | CCCCCCCCCC(O)CCCCCCCC |
| InChI | InChI=1S/C18H38O/c1-3-5-7-9-11-13-15-17-18(19)16-14-12-10-8-6-4-2/h18-19H,3-17H2,1-2H3 |
| InChIKey | URMHMMMIVAECEM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Capsicum annuum (ncbitaxon:4072) | - | DOI (10.1016/j.jpba.2007.07.025) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| octadecan-9-ol (CHEBI:197467) has role plant metabolite (CHEBI:76924) |
| octadecan-9-ol (CHEBI:197467) is a octadecanol (CHEBI:197457) |
| octadecan-9-ol (CHEBI:197467) is a secondary fatty alcohol (CHEBI:167095) |
| IUPAC Name |
|---|
| octadecan-9-ol |
| Synonyms | Source |
|---|---|
| 9-hydroxyoctadecane | ChEBI |
| 9-octadecanol | ChEBI |
| nonyloctyl carbinol | ChEBI |
| octyldecanol | ChEBI |
| octyl decyl alcohol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:591-70-8 | ChEBI |