EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H18N2O3 |
| Net Charge | 0 |
| Average Mass | 202.254 |
| Monoisotopic Mass | 202.13174 |
| SMILES | CC(=O)N(C)CCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C9H18N2O3/c1-7(12)11(2)6-4-3-5-8(10)9(13)14/h8H,3-6,10H2,1-2H3,(H,13,14)/t8-/m0/s1 |
| InChIKey | JDOAXXVMDRGGTF-QMMMGPOBSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N6-acetyl-N6-methyl-L-lysine (CHEBI:197458) has functional parent N6-methyl-L-lysine (CHEBI:17604) |
| N6-acetyl-N6-methyl-L-lysine (CHEBI:197458) is a L-lysine derivative (CHEBI:25095) |
| N6-acetyl-N6-methyl-L-lysine (CHEBI:197458) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| N6-acetyl-N6-methyl-L-lysine (CHEBI:197458) is a tertiary carboxamide (CHEBI:140326) |
| Incoming Relation(s) |
| N6-acetyl-N6-methyl-L-lysine residue (CHEBI:197459) is substituent group from N6-acetyl-N6-methyl-L-lysine (CHEBI:197458) |
| IUPAC Name |
|---|
| N6-acetyl-N6-methyl-L-lysine |
| Synonyms | Source |
|---|---|
| (2S)-6-[acetyl(methyl)amino]-2-aminohexanoic acid | IUPAC |
| Nε-acetyl-Nε-methyllysine | ChEBI |
| Nε-acetyl-Nε-methyl-L-lysine | ChEBI |
| Kacme | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| 7QK | PDBeChem |
| Citations |
|---|