EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H36O |
| Net Charge | 0 |
| Average Mass | 256.474 |
| Monoisotopic Mass | 256.27662 |
| SMILES | CCCCCCCCCCCCCCC(O)CC |
| InChI | InChI=1S/C17H36O/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17(18)4-2/h17-18H,3-16H2,1-2H3 |
| InChIKey | RPXAJGVDKFLODX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Andrographis macrobotrys (ncbitaxon:2566160) | |||
| leaf (BTO:0000713) | PubMed (37240810) | ||
| stem (BTO:0001300) | PubMed (37240810) | ||
| Root (BTO:0001188) | PubMed (37240810) | ||
| Garcinia morella (ncbitaxon:1585849) | latex (BTO:0000710) | PubMed (28848256) | |
| Moringa oleifera (ncbitaxon:3735) | seed (BTO:0001226) | PubMed (32823699) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| heptadecan-3-ol (CHEBI:197450) has role plant metabolite (CHEBI:76924) |
| heptadecan-3-ol (CHEBI:197450) is a heptadecanol (CHEBI:197399) |
| heptadecan-3-ol (CHEBI:197450) is a secondary fatty alcohol (CHEBI:167095) |
| IUPAC Name |
|---|
| heptadecan-3-ol |
| Synonyms | Source |
|---|---|
| 3-hydroxyheptadecane | ChEBI |
| 3-heptadecanol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:84534-30-5 | NIST Chemistry WebBook |
| Citations |
|---|