EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H19N4.Cl |
| Net Charge | 0 |
| Average Mass | 350.853 |
| Monoisotopic Mass | 350.12982 |
| SMILES | Cc1cc2nc3cc(C)c(N)cc3[n+](-c3ccccc3)c2cc1N.[Cl-] |
| InChI | InChI=1S/C20H18N4.ClH/c1-12-8-17-19(10-15(12)21)24(14-6-4-3-5-7-14)20-11-16(22)13(2)9-18(20)23-17;/h3-11H,1-2H3,(H3,21,22);1H |
| InChIKey | OARRHUQTFTUEOS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| safranin O (CHEBI:197447) has part 3,7-diamino-2,8-dimethyl-5-phenylphenazin-5-ium (CHEBI:197448) |
| safranin O (CHEBI:197447) has role fluorochrome (CHEBI:51217) |
| safranin O (CHEBI:197447) has role histological dye (CHEBI:77178) |
| safranin O (CHEBI:197447) is a organic chloride salt (CHEBI:36094) |
| IUPAC Name |
|---|
| 3,7-diamino-2,8-dimethyl-5-phenylphenazin-5-ium chloride |
| Synonyms | Source |
|---|---|
| 3,7-diamino-2,8-dimethyl-5-phenazinium chloride | ChEBI |
| safranine O | ChEBI |
| C.I. basic red 2 | ChEBI |
| C.I. 50240 | ChEBI |
| safranin | ChEBI |
| safranine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Safranin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3924099 | Reaxys |
| CAS:477-73-6 | ChEBI |
| Citations |
|---|