EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H13NO5 |
| Net Charge | 0 |
| Average Mass | 287.271 |
| Monoisotopic Mass | 287.07937 |
| SMILES | COc1cc2nc3cc(CO)ccc3oc-2c(OC)c1=O |
| InChI | InChI=1S/C15H13NO5/c1-19-12-6-10-14(15(20-2)13(12)18)21-11-4-3-8(7-17)5-9(11)16-10/h3-6,17H,7H2,1-2H3 |
| InChIKey | DSDZKWZYXPNNCJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces xanthochromogenes (ncbitaxon:67384) | - | PubMed (814873) | Species also known as Streptomyces michiganensis. Strain: Tü 1074 |
| Roles Classification |
|---|
| Biological Roles: | biological pigment An endogenous molecular entity that results in a colour of an organism as the consequence of the selective absorption of light. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| michigazone (CHEBI:197443) has role bacterial metabolite (CHEBI:76969) |
| michigazone (CHEBI:197443) has role biological pigment (CHEBI:26130) |
| michigazone (CHEBI:197443) has role neuroprotective agent (CHEBI:63726) |
| michigazone (CHEBI:197443) is a aromatic primary alcohol (CHEBI:33857) |
| michigazone (CHEBI:197443) is a cyclic ketone (CHEBI:3992) |
| michigazone (CHEBI:197443) is a diether (CHEBI:46786) |
| michigazone (CHEBI:197443) is a phenoxazine (CHEBI:25970) |
| IUPAC Name |
|---|
| 8-(hydroxymethyl)-2,4-dimethoxy-3H-phenoxazin-3-one |
| Synonyms | Source |
|---|---|
| 8-hydroxymethyl-2,4-dimethoxy-3H-phenoxazine-3-one | SUBMITTER |
| Michigazon | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| CAS:62267-63-4 | SUBMITTER |
| Citations |
|---|