EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10N2O4 |
| Net Charge | 0 |
| Average Mass | 270.244 |
| Monoisotopic Mass | 270.06406 |
| SMILES | CNc1cc2nc3cc(C(=O)O)ccc3oc-2cc1=O |
| InChI | InChI=1S/C14H10N2O4/c1-15-8-5-10-13(6-11(8)17)20-12-3-2-7(14(18)19)4-9(12)16-10/h2-6,15H,1H3,(H,18,19) |
| InChIKey | ATNNDPCZMYLOOB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharopolyspora taberi (ncbitaxon:60895) | - | PubMed (6874591) | Strain: LL-WRAT 210 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| texazone (CHEBI:197442) has role bacterial metabolite (CHEBI:76969) |
| texazone (CHEBI:197442) is a cyclic ketone (CHEBI:3992) |
| texazone (CHEBI:197442) is a monocarboxylic acid (CHEBI:25384) |
| texazone (CHEBI:197442) is a phenoxazine (CHEBI:25970) |
| texazone (CHEBI:197442) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 2-(methylamino)-3-oxo-3H-phenoxazine-8-carboxylic acid |
| Synonym | Source |
|---|---|
| 2-(N-methylamino)-3H-phenoxazin-3-one-8-carboxylic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00018509 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:87081-53-6 | SUBMITTER |
| Citations |
|---|