EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H17NO8 |
| Net Charge | 0 |
| Average Mass | 291.256 |
| Monoisotopic Mass | 291.09542 |
| SMILES | [H][C@@]12C[C@](C[C@H](N)C(=O)O)(C(=O)O)O[C@]1([H])[C@H](O)[C@H](O)CO2 |
| InChI | InChI=1S/C11H17NO8/c12-4(9(15)16)1-11(10(17)18)2-6-8(20-11)7(14)5(13)3-19-6/h4-8,13-14H,1-3,12H2,(H,15,16)(H,17,18)/t4-,5+,6+,7+,8-,11+/m0/s1 |
| InChIKey | NRTJEXLNSCGBJU-FQYLSUDWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dysidea herbacea (WORMS:220470) | - | PubMed (11388846) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. excitatory amino acid agonist An agent that binds to and activates excitatory amino acid receptors. |
| Application: | excitatory amino acid agonist An agent that binds to and activates excitatory amino acid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| neodysiherbaine A (CHEBI:197441) has role animal metabolite (CHEBI:75767) |
| neodysiherbaine A (CHEBI:197441) has role excitatory amino acid agonist (CHEBI:50103) |
| neodysiherbaine A (CHEBI:197441) has role marine metabolite (CHEBI:76507) |
| neodysiherbaine A (CHEBI:197441) is a amino dicarboxylic acid (CHEBI:36164) |
| neodysiherbaine A (CHEBI:197441) is a diol (CHEBI:23824) |
| neodysiherbaine A (CHEBI:197441) is a furopyran (CHEBI:74927) |
| neodysiherbaine A (CHEBI:197441) is a hydroxy carboxylic acid (CHEBI:24669) |
| IUPAC Name |
|---|
| (2R,3aR,6R,7R,7aR)-2-[(2S)-2-amino-2-carboxyethyl]-6,7-dihydroxyhexahydro-2H-furo[3,2-b]pyran-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| NDH | SUBMITTER |
| (−)-neodysiherbaine A | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| NDZ | PDBeChem |
| Citations |
|---|