EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H20N6O |
| Net Charge | 0 |
| Average Mass | 396.454 |
| Monoisotopic Mass | 396.16986 |
| SMILES | Nc1ccccc1NC(=O)c1ccc(CNc2nccc(-c3cccnc3)n2)cc1 |
| InChI | InChI=1S/C23H20N6O/c24-19-5-1-2-6-21(19)28-22(30)17-9-7-16(8-10-17)14-27-23-26-13-11-20(29-23)18-4-3-12-25-15-18/h1-13,15H,14,24H2,(H,28,30)(H,26,27,29) |
| InChIKey | HRNLUBSXIHFDHP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. autophagy inducer Any compound that induces the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. |
| Applications: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mocetinostat (CHEBI:197437) has role antineoplastic agent (CHEBI:35610) |
| mocetinostat (CHEBI:197437) has role apoptosis inducer (CHEBI:68495) |
| mocetinostat (CHEBI:197437) has role autophagy inducer (CHEBI:138880) |
| mocetinostat (CHEBI:197437) has role cardioprotective agent (CHEBI:77307) |
| mocetinostat (CHEBI:197437) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| mocetinostat (CHEBI:197437) has role hepatotoxic agent (CHEBI:50908) |
| mocetinostat (CHEBI:197437) is a aminopyrimidine (CHEBI:38338) |
| mocetinostat (CHEBI:197437) is a benzamides (CHEBI:22702) |
| mocetinostat (CHEBI:197437) is a pyridines (CHEBI:26421) |
| mocetinostat (CHEBI:197437) is a secondary amino compound (CHEBI:50995) |
| mocetinostat (CHEBI:197437) is a secondary carboxamide (CHEBI:140325) |
| mocetinostat (CHEBI:197437) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| N-(2-aminophenyl)-4-({[4-(pyridin-3-yl)pyrimidin-2-yl]amino}methyl)benzamide |
| INNs | Source |
|---|---|
| mocetinostat | WHO MedNet |
| mocetinostat | WHO MedNet |
| mocetinostatum | WHO MedNet |
| mocétinostat | WHO MedNet |
| Synonyms | Source |
|---|---|
| MGCD0103 | DrugBank |
| N-(2-aminophenyl)-4-[[[4-(3-pyridinyl)-2-pyrimidinyl]amino]methyl]benzamide | ChEBI |
| MGCD-0103 | DrugBank |
| MGCD 0103 | ChEBI |
| MG 0103 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-5344 | LINCS |
| DB11830 | DrugBank |
| HMDB0254820 | HMDB |
| Mocetinostat | Wikipedia |
| D09641 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:726169-73-9 | SUBMITTER |
| Citations |
|---|