EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20N2O7 |
| Net Charge | 0 |
| Average Mass | 304.299 |
| Monoisotopic Mass | 304.12705 |
| SMILES | [H][C@@]12C[C@](C[C@H](N)C(=O)O)(C(=O)O)O[C@]1([H])[C@H](NC)[C@H](O)CO2 |
| InChI | InChI=1S/C12H20N2O7/c1-14-8-6(15)4-20-7-3-12(11(18)19,21-9(7)8)2-5(13)10(16)17/h5-9,14-15H,2-4,13H2,1H3,(H,16,17)(H,18,19)/t5-,6+,7+,8+,9-,12+/m0/s1 |
| InChIKey | YUSZFKPLFIQTGF-FDNSHYBFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dysidea herbacea (WORMS:220470) | - | DOI (10.1021/ja963953z) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. neurotoxin A poison that interferes with the functions of the nervous system. excitatory amino acid agonist An agent that binds to and activates excitatory amino acid receptors. |
| Application: | excitatory amino acid agonist An agent that binds to and activates excitatory amino acid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dysiherbaine (CHEBI:197431) has role animal metabolite (CHEBI:75767) |
| dysiherbaine (CHEBI:197431) has role excitatory amino acid agonist (CHEBI:50103) |
| dysiherbaine (CHEBI:197431) has role marine metabolite (CHEBI:76507) |
| dysiherbaine (CHEBI:197431) has role neurotoxin (CHEBI:50910) |
| dysiherbaine (CHEBI:197431) is a amino dicarboxylic acid (CHEBI:36164) |
| dysiherbaine (CHEBI:197431) is a furopyran (CHEBI:74927) |
| dysiherbaine (CHEBI:197431) is a hydroxy carboxylic acid (CHEBI:24669) |
| dysiherbaine (CHEBI:197431) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| (2R,3aR,6S,7R,7aR)-2-[(2S)-2-amino-2-carboxyethyl]-6-hydroxy-7-(methylamino)hexahydro-2H-furo[3,2-b]pyran-2-carboxylic acid |
| Synonym | Source |
|---|---|
| (−)-dysiherbaine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00028227 | KNApSAcK |
| DYH | PDBeChem |
| WO2004089956 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:185245-55-0 | SUBMITTER |
| Citations |
|---|