EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20N2O7 |
| Net Charge | 0 |
| Average Mass | 304.299 |
| Monoisotopic Mass | 304.12705 |
| SMILES | [H][C@@]12C[C@](C[C@H](N)C(=O)O)(C(=O)O)O[C@]1([H])[C@H](NC)[C@H](O)CO2 |
| InChI | InChI=1S/C12H20N2O7/c1-14-8-6(15)4-20-7-3-12(11(18)19,21-9(7)8)2-5(13)10(16)17/h5-9,14-15H,2-4,13H2,1H3,(H,16,17)(H,18,19)/t5-,6+,7+,8+,9-,12+/m0/s1 |
| InChIKey | YUSZFKPLFIQTGF-FDNSHYBFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dysidea herbacea (WORMS:220470) | - | DOI (10.1021/ja963953z) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. neurotoxin A poison that interferes with the functions of the nervous system. excitatory amino acid agonist An agent that binds to and activates excitatory amino acid receptors. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| Application: | excitatory amino acid agonist An agent that binds to and activates excitatory amino acid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dysiherbaine (CHEBI:197431) has role animal metabolite (CHEBI:75767) |
| dysiherbaine (CHEBI:197431) has role excitatory amino acid agonist (CHEBI:50103) |
| dysiherbaine (CHEBI:197431) has role marine metabolite (CHEBI:76507) |
| dysiherbaine (CHEBI:197431) has role neurotoxin (CHEBI:50910) |
| dysiherbaine (CHEBI:197431) is a amino dicarboxylic acid (CHEBI:36164) |
| dysiherbaine (CHEBI:197431) is a furopyran (CHEBI:74927) |
| dysiherbaine (CHEBI:197431) is a hydroxy carboxylic acid (CHEBI:24669) |
| dysiherbaine (CHEBI:197431) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| (2R,3aR,6S,7R,7aR)-2-[(2S)-2-amino-2-carboxyethyl]-6-hydroxy-7-(methylamino)hexahydro-2H-furo[3,2-b]pyran-2-carboxylic acid |
| Synonym | Source |
|---|---|
| (−)-dysiherbaine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| DYH | PDBeChem |
| C00028227 | KNApSAcK |
| WO2004089956 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:185245-55-0 | SUBMITTER |
| Citations |
|---|