EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H36N2O2.HCl |
| Net Charge | 0 |
| Average Mass | 493.091 |
| Monoisotopic Mass | 492.25436 |
| SMILES | COc1ccc2c(c1)C(C(=O)N(Cc1ccc(N(C)C)cc1)c1ccc(C(C)C)cc1)CCC2.Cl |
| InChI | InChI=1S/C30H36N2O2.ClH/c1-21(2)23-11-16-26(17-12-23)32(20-22-9-14-25(15-10-22)31(3)4)30(33)28-8-6-7-24-13-18-27(34-5)19-29(24)28;/h9-19,21,28H,6-8,20H2,1-5H3;1H |
| InChIKey | UKBJWRMNGCDKNL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | C5a receptor antagonist Any antagonist of the C5a receptor. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| W54011 (CHEBI:197423) has role anti-inflammatory agent (CHEBI:67079) |
| W54011 (CHEBI:197423) has role C5a receptor antagonist (CHEBI:144895) |
| W54011 (CHEBI:197423) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| N-[4-(dimethylamino)benzyl]-7-methoxy-N-[4-(propan-2-yl)phenyl]-1,2,3,4-tetrahydronaphthalene-1-carboxamide hydrochloride |
| Synonyms | Source |
|---|---|
| N-((4-dimethylaminophenyl)methyl)-N-(4-isopropylphenyl)-7-methoxy-1,2,3,4-tetrahydronaphthalen-1-carboxamide hydrochloride | SUBMITTER |
| W 54011 | ChEBI |
| W-54011 | ChEBI |
| C5a receptor antagonist, W-54011 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:405098-33-1 | SUBMITTER |
| Citations |
|---|