EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:197400 - heptadecan-2-ol
| Formula | C17H36O |
| Net Charge | 0 |
| Average Mass | 256.474 |
| Monoisotopic Mass | 256.27662 |
| SMILES | CCCCCCCCCCCCCCCC(C)O |
| InChI | InChI=1S/C17H36O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(2)18/h17-18H,3-16H2,1-2H3 |
| InChIKey | ZNYQHFLBAPNPRC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oleria onega (ncbitaxon:304530) | - | PubMed (31493166) | |
| Paeonia suffruticosa (ncbitaxon:45171) | - | PubMed (35566179) | |
| Exiguobacterium acetylicum (ncbitaxon:41170) | - | PubMed (31485468) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| heptadecan-2-ol (CHEBI:197400) has role animal metabolite (CHEBI:75767) |
| heptadecan-2-ol (CHEBI:197400) has role bacterial metabolite (CHEBI:76969) |
| heptadecan-2-ol (CHEBI:197400) has role plant metabolite (CHEBI:76924) |
| heptadecan-2-ol (CHEBI:197400) is a heptadecanol (CHEBI:197399) |
| heptadecan-2-ol (CHEBI:197400) is a secondary fatty alcohol (CHEBI:167095) |
| IUPAC Name |
|---|
| heptadecan-2-ol |
| Synonyms | Source |
|---|---|
| 2-heptadecanol | NIST Chemistry WebBook |
| 2-hydroxyheptadecane | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA05000531 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:16813-18-6 | NIST Chemistry WebBook |
| Citations |
|---|