EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H34O |
| Net Charge | 0 |
| Average Mass | 242.447 |
| Monoisotopic Mass | 242.26097 |
| SMILES | CCCCCCCCCCCC(O)CCCC |
| InChI | InChI=1S/C16H34O/c1-3-5-7-8-9-10-11-12-13-15-16(17)14-6-4-2/h16-17H,3-15H2,1-2H3 |
| InChIKey | HNDLTSNUZCYNRL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Prototheca zopfii (ncbitaxon:3112) | - | PubMed (23651808) |
| Roles Classification |
|---|
| Biological Role: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hexadecan-5-ol (CHEBI:197395) has role algal metabolite (CHEBI:84735) |
| hexadecan-5-ol (CHEBI:197395) is a hexadecanol (CHEBI:197387) |
| hexadecan-5-ol (CHEBI:197395) is a secondary fatty alcohol (CHEBI:167095) |
| IUPAC Name |
|---|
| hexadecan-5-ol |
| Synonyms | Source |
|---|---|
| 5-hexadecanol | NIST Chemistry WebBook |
| 5-hydroxyhexadecane | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:21078-87-5 | NIST Chemistry WebBook |
| Citations |
|---|