EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:197390 - hexadecan-3-ol
| Formula | C16H34O |
| Net Charge | 0 |
| Average Mass | 242.447 |
| Monoisotopic Mass | 242.26097 |
| SMILES | CCCCCCCCCCCCCC(O)CC |
| InChI | InChI=1S/C16H34O/c1-3-5-6-7-8-9-10-11-12-13-14-15-16(17)4-2/h16-17H,3-15H2,1-2H3 |
| InChIKey | ACDUHTSVVVHMGU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillus safensis (ncbitaxon:561879) | - | PubMed (34076810) | |
| Capsicum annuum (ncbitaxon:4072) | - | PubMed (32961789) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hexadecan-3-ol (CHEBI:197390) has role bacterial metabolite (CHEBI:76969) |
| hexadecan-3-ol (CHEBI:197390) has role plant metabolite (CHEBI:76924) |
| hexadecan-3-ol (CHEBI:197390) is a hexadecanol (CHEBI:197387) |
| hexadecan-3-ol (CHEBI:197390) is a secondary fatty alcohol (CHEBI:167095) |
| IUPAC Name |
|---|
| hexadecan-3-ol |
| Synonyms | Source |
|---|---|
| 3-hexadecanol | NIST Chemistry WebBook |
| 3-hydroxyhexadecane | ChEBI |
| ethyl n-tridecyl carbinol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:593-03-3 | NIST Chemistry WebBook |
| Citations |
|---|