EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H32O |
| Net Charge | 0 |
| Average Mass | 228.420 |
| Monoisotopic Mass | 228.24532 |
| SMILES | CCCCCCCC(O)CCCCCCC |
| InChI | InChI=1S/C15H32O/c1-3-5-7-9-11-13-15(16)14-12-10-8-6-4-2/h15-16H,3-14H2,1-2H3 |
| InChIKey | AXCJQGZCVXCVAG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Adiantum capillus-veneris (ncbitaxon:13818) | - | PubMed (37375275) | Found in unsaponifiable matter. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pentadecan-8-ol (CHEBI:197385) has role plant metabolite (CHEBI:76924) |
| pentadecan-8-ol (CHEBI:197385) is a pentadecanol (CHEBI:195629) |
| pentadecan-8-ol (CHEBI:197385) is a secondary fatty alcohol (CHEBI:167095) |
| IUPAC Name |
|---|
| pentadecan-8-ol |
| Synonyms | Source |
|---|---|
| 8-pentadecanol | ChEBI |
| 8-hydroxypentadecane | ChEBI |
| 1-heptyloctyl alcohol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:1653-35-6 | NIST Chemistry WebBook |
| Citations |
|---|