EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H32O |
| Net Charge | 0 |
| Average Mass | 228.420 |
| Monoisotopic Mass | 228.24532 |
| SMILES | CCCCCCCCCCCCCC(C)O |
| InChI | InChI=1S/C15H32O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15(2)16/h15-16H,3-14H2,1-2H3 |
| InChIKey | ALVGHPMGQNBJRC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chamaerops humilis (ncbitaxon:54446) | - | PubMed (34063074) | |
| Clostridium butyricum (ncbitaxon:1492) | - | PubMed (690515) | |
| Escherichia coli (ncbitaxon:562) | - | PubMed (28649963) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pentadecan-2-ol (CHEBI:197379) has role Escherichia coli metabolite (CHEBI:76971) |
| pentadecan-2-ol (CHEBI:197379) has role bacterial metabolite (CHEBI:76969) |
| pentadecan-2-ol (CHEBI:197379) has role pheromone (CHEBI:26013) |
| pentadecan-2-ol (CHEBI:197379) has role plant metabolite (CHEBI:76924) |
| pentadecan-2-ol (CHEBI:197379) is a pentadecanol (CHEBI:195629) |
| pentadecan-2-ol (CHEBI:197379) is a secondary fatty alcohol (CHEBI:167095) |
| IUPAC Name |
|---|
| pentadecan-2-ol |
| Synonyms | Source |
|---|---|
| 2-hydroxypentadecane | ChEBI |
| 2-pentadecanol | NIST Chemistry WebBook |
| sec-pentadecyl alcohol | NIST Chemistry WebBook |
| methyl n-tridecyl carbinol | ChEBI |
| pentadecanol-(2) | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA05000526 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:1653-34-5 | NIST Chemistry WebBook |
| Citations |
|---|