EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H46O12 |
| Net Charge | 0 |
| Average Mass | 610.697 |
| Monoisotopic Mass | 610.29893 |
| SMILES | [H][C@]12CCO[C@@]1([H])O[C@]([H])([C@@]1(C)[C@H](C)C[C@H](OC(C)=O)[C@]3(COC(C)=O)[C@]1([H])[C@H](O)[C@@H](OC(C)=O)[C@H](OC(=O)C(C)CC)[C@]31CO1)C2 |
| InChI | InChI=1S/C31H46O12/c1-8-15(2)27(36)43-26-24(41-19(6)34)23(35)25-29(7,21-12-20-9-10-37-28(20)42-21)16(3)11-22(40-18(5)33)30(25,13-38-17(4)32)31(26)14-39-31/h15-16,20-26,28,35H,8-14H2,1-7H3/t15?,16-,20-,21+,22+,23-,24-,25-,26+,28+,29-,30-,31-/m1/s1 |
| InChIKey | MMLPTCVXPCYZCP-HHERFIPJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ajuga reptans (ncbitaxon:38596) | aerial part (BTO:0001658) | DOI (10.1016/S0031-9422(98)00445-2) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| areptin A (CHEBI:197378) has role plant metabolite (CHEBI:76924) |
| areptin A (CHEBI:197378) is a acetate ester (CHEBI:47622) |
| areptin A (CHEBI:197378) is a carboxylic ester (CHEBI:33308) |
| areptin A (CHEBI:197378) is a cyclic acetal (CHEBI:59770) |
| areptin A (CHEBI:197378) is a diterpenoid (CHEBI:23849) |
| areptin A (CHEBI:197378) is a furofuran (CHEBI:47790) |
| areptin A (CHEBI:197378) is a secondary alcohol (CHEBI:35681) |
| areptin A (CHEBI:197378) is a spiro-epoxide (CHEBI:133131) |
| IUPAC Name |
|---|
| (1R,2S,3R,4S,4aR,5S,6R,8S,8aR)-3,8-bis(acetyloxy)-8a-[(acetyloxy)methyl]-5-[(2S,3aR,6aS)-hexahydrofuro[2,3-b]furan-2-yl]-4-hydroxy-5,6-dimethyloctahydro-2H-spiro[naphthalene-1,2'-oxiran]-2-yl 2-methylbutanoate |
| Synonym | Source |
|---|---|
| (11S,13R,16S)-2α,6α,19-triacetoxy-3β-(2-methylbutyryloxy)-4α, 18:11, 16:15, 16-triepoxy-neo-clerodan-1β-ol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00040876 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:220997-80-8 | KNApSAcK |
| Citations |
|---|