EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H40O10 |
| Net Charge | 0 |
| Average Mass | 548.629 |
| Monoisotopic Mass | 548.26215 |
| SMILES | [H][C@@]12OC=C[C@]1([H])C[C@@]([H])([C@@]1(C)[C@H](C)C[C@H](OC(C)=O)[C@]3(COC(C)=O)[C@]1([H])[C@H](OC(=O)/C(C)=C/C)C[C@H](O)[C@]31CO1)O2 |
| InChI | InChI=1S/C29H40O10/c1-7-15(2)25(33)38-20-12-21(32)29(14-36-29)28(13-35-17(4)30)23(37-18(5)31)10-16(3)27(6,24(20)28)22-11-19-8-9-34-26(19)39-22/h7-9,16,19-24,26,32H,10-14H2,1-6H3/b15-7+/t16-,19-,20-,21+,22+,23+,24-,26+,27-,28-,29-/m1/s1 |
| InChIKey | VHMXRHYBQSWLTN-JHNLQVKESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ajuga reptans (ncbitaxon:38596) | aerial part (BTO:0001658) | DOI ( 10.1016/S0031-9422(98)00445-2) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| areptin B (CHEBI:197377) has role plant metabolite (CHEBI:76924) |
| areptin B (CHEBI:197377) is a acetate ester (CHEBI:47622) |
| areptin B (CHEBI:197377) is a carboxylic ester (CHEBI:33308) |
| areptin B (CHEBI:197377) is a cyclic acetal (CHEBI:59770) |
| areptin B (CHEBI:197377) is a diterpenoid (CHEBI:23849) |
| areptin B (CHEBI:197377) is a furofuran (CHEBI:47790) |
| areptin B (CHEBI:197377) is a secondary alcohol (CHEBI:35681) |
| areptin B (CHEBI:197377) is a spiro-epoxide (CHEBI:133131) |
| IUPAC Name |
|---|
| (1R,2S,4R,4aR,5S,6R,8S,8aR)-8-(acetyloxy)-8a-[(acetyloxy)methyl]-2-hydroxy-5,6-dimethyl-5-[(2S,3aS,6aS)-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-2-yl]octahydro-2H-spiro[naphthalene-1,2'-oxiran]-4-yl (2E)-2-methylbut-2-enoate |
| Synonym | Source |
|---|---|
| (11S,13S,16S)-6α,19-diacetoxy-1β [(E)-2-methyl-2-butenoyloxy]-4α, 18:11, 16:15, 16-triepoxy-neo-cleroda-14-en-3β-ol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00040877 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:220997-81-9 | KNApSAcK |
| Citations |
|---|