EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H30O |
| Net Charge | 0 |
| Average Mass | 214.393 |
| Monoisotopic Mass | 214.22967 |
| SMILES | CCCCCCCCCCC(O)CCC |
| InChI | InChI=1S/C14H30O/c1-3-5-6-7-8-9-10-11-13-14(15)12-4-2/h14-15H,3-13H2,1-2H3 |
| InChIKey | HRDGAIGDKJXHIU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Syzygium fruticosum (ncbitaxon:1679312) | seed (BTO:0001226) | PubMed (33671381) | |
| Cissus quadrangularis (ncbitaxon:165298) | - | PubMed (33463919) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetradecan-4-ol (CHEBI:197371) has role plant metabolite (CHEBI:76924) |
| tetradecan-4-ol (CHEBI:197371) is a secondary fatty alcohol (CHEBI:167095) |
| tetradecan-4-ol (CHEBI:197371) is a tetradecanol (CHEBI:195550) |
| IUPAC Name |
|---|
| tetradecan-4-ol |
| Synonyms | Source |
|---|---|
| 4-hydroxytetradecane | ChEBI |
| 4-tetradecanol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:1653-33-4 | NIST Chemistry WebBook |
| Citations |
|---|