EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H27F3N4OS |
| Net Charge | 0 |
| Average Mass | 464.557 |
| Monoisotopic Mass | 464.18577 |
| SMILES | FC(F)(F)c1ccc2c(SCCCCCn3cnc(CN4CCOCC4)c3)ccnc2c1 |
| InChI | InChI=1S/C23H27F3N4OS/c24-23(25,26)18-4-5-20-21(14-18)27-7-6-22(20)32-13-3-1-2-8-30-16-19(28-17-30)15-29-9-11-31-12-10-29/h4-7,14,16-17H,1-3,8-13,15H2 |
| InChIKey | UEZJAHLAEKXBTP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | Rac1 inhibitor Any inhibitor of Rac1. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GYS32661 (CHEBI:197341) has role antineoplastic agent (CHEBI:35610) |
| GYS32661 (CHEBI:197341) has role Rac1 inhibitor (CHEBI:197347) |
| GYS32661 (CHEBI:197341) is a aryl sulfide (CHEBI:35683) |
| GYS32661 (CHEBI:197341) is a imidazoles (CHEBI:24780) |
| GYS32661 (CHEBI:197341) is a morpholines (CHEBI:38785) |
| GYS32661 (CHEBI:197341) is a organofluorine compound (CHEBI:37143) |
| GYS32661 (CHEBI:197341) is a quinolines (CHEBI:26513) |
| GYS32661 (CHEBI:197341) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 4-({5-[4-(morpholin-4-ylmethyl)-1H-imidazol-1-yl]pentyl}sulfanyl)-7-(trifluoromethyl)quinoline |
| Synonyms | Source |
|---|---|
| 4-((1-(5-((7-(trifluoromethyl)quinolin-4-yl)thio)pentyl)-1H-imidazol-4-yl)methyl)morpholine | ChEBI |
| GYS-32661 | SUBMITTER |
| GYS 32661 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:2589092-11-3 | SUBMITTER |
| Citations |
|---|