EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H36O2 |
| Net Charge | 0 |
| Average Mass | 332.528 |
| Monoisotopic Mass | 332.27153 |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCCCCCC(=O)O |
| InChI | InChI=1S/C22H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h3-4,6-7,9-10,12-13H,2,5,8,11,14-21H2,1H3,(H,23,24)/b4-3-,7-6-,10-9-,13-12- |
| InChIKey | IGFLWIHPPADNDL-LTKCOYKYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (37402773) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lynenic acid (CHEBI:197291) is a docosatetraenoic acid (CHEBI:61205) |
| lynenic acid (CHEBI:197291) is conjugate acid of lynenic acid anion (CHEBI:229686) |
| Incoming Relation(s) |
| lynenic acid anion (CHEBI:229686) is conjugate base of lynenic acid (CHEBI:197291) |
| IUPAC Name |
|---|
| (10Z,13Z,16Z,19Z)-docosa-10,13,16,19-tetraenoic acid |
| Synonyms | Source |
|---|---|
| (10Z,13Z,16Z,19Z)-docosatetraenoic acid | ChEBI |
| 10Z,13Z,16Z,19Z-docosatetraenoic acid | LIPID MAPS |
| FA 22:4n-3,6,9,12 | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| LMFA01031304 | LIPID MAPS |
| Citations |
|---|