EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30O4 |
| Net Charge | 0 |
| Average Mass | 358.478 |
| Monoisotopic Mass | 358.21441 |
| SMILES | CC/C=C\C/C=C\C[C@@H]1C(=O)C=C[C@@H]1/C=C/[C@H](O)C/C=C\CCC(=O)O |
| InChI | InChI=1S/C22H30O4/c1-2-3-4-5-6-9-12-20-18(15-17-21(20)24)14-16-19(23)11-8-7-10-13-22(25)26/h3-4,6-9,14-20,23H,2,5,10-13H2,1H3,(H,25,26)/b4-3-,8-7-,9-6-,16-14+/t18-,19+,20-/m0/s1 |
| InChIKey | MXOPSUCJZLSXRJ-NERXNVSSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cannabis sativa (ncbitaxon:3483) | inflorescence (BTO:0000628) | MetaboLights (MTBLS6032) | Strain: Cannabis sativa var. DMG265 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-epi-7-J4-NeuroP (CHEBI:197263) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (4Z,7R,8E)-7-hydroxy-9-[(1S,5S)-5-[(2Z,5Z)-octa-2,5-dienyl]-4-oxocyclopent-2-en-1-yl]nona-4,8-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 113370482 | ChemSpider |
| LMFA04010467 | LIPID MAPS |