EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H30O5 |
| Net Charge | 0 |
| Average Mass | 398.499 |
| Monoisotopic Mass | 398.20932 |
| SMILES | [H][C@]12C[C@@H](O)[C@H](/C=C/[C@@H](O)C3CCCCC3)[C@@]1([H])C/C(=C/c1cccc(C(=O)O)c1)O2 |
| InChI | InChI=1S/C24H30O5/c25-21(16-6-2-1-3-7-16)10-9-19-20-13-18(29-23(20)14-22(19)26)12-15-5-4-8-17(11-15)24(27)28/h4-5,8-12,16,19-23,25-26H,1-3,6-7,13-14H2,(H,27,28)/b10-9+,18-12-/t19-,20-,21-,22-,23+/m1/s1 |
| InChIKey | ZLJOKYGJNOQXDP-OZUBPDBUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cannabis sativa (ncbitaxon:3483) | inflorescence (BTO:0000628) | MetaboLights (MTBLS6032) | Strain: Cannabis sativa var. DMG265 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Taprostene (CHEBI:197230) is a benzoic acids (CHEBI:22723) |
| IUPAC Name |
|---|
| 3-[(Z)-[(3aR,4R,5R,6aS)-4-[(E,3S)-3-cyclohexyl-3-hydroxyprop-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]uran-2-ylidene]methyl]benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4470762 | ChemSpider |