EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C51H91O18P |
| Net Charge | 0 |
| Average Mass | 1023.245 |
| Monoisotopic Mass | 1022.59430 |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(O)O[C@@H]1C(O)C(O)[C@@H](O)C(O)[C@H]1O[C@H]1OC(CO)[C@@H](O)C(O)[C@H]1O)OC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C51H91O18P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-40(53)64-36-38(66-41(54)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2)37-65-70(62,63)69-50-47(60)45(58)44(57)46(59)49(50)68-51-48(61)43(56)42(55)39(35-52)67-51/h11,13,17-20,38-39,42-52,55-61H,3-10,12,14-16,21-37H2,1-2H3,(H,62,63)/b13-11-,19-17-,20-18-/t38-,39?,42-,43?,44-,45?,46?,47?,48-,49-,50-,51-/m1/s1 |
| InChIKey | GSNPRBBRNYSAQM-QYPGKCRPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cannabis sativa (ncbitaxon:3483) | inflorescence (BTO:0000628) | MetaboLights (MTBLS6032) | Strain: Cannabis sativa var. DMG265 |
| Roles Classification |
|---|
| Biological Role: | antigen Any substance that stimulates an immune response in the body, such as through antibody production or by presentation to a T-cell receptor after binding to a major histocompability complex (MHC). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PIM1(18:2(9Z,12Z)/18:1(9Z)) (CHEBI:197215) is a phosphatidylinositol mannoside (CHEBI:59466) |
| IUPAC Name |
|---|
| [(2R)-1-[hydroxy-[(1R,4R,6R)-2,3,4,5-tetrahydroxy-6-[(2R,3R,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclohexyl]oxyphosphoryl]oxy-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropan-2-yl] (Z)-octadec-9-enoate |
| Manual Xrefs | Databases |
|---|---|
| LMGP15010031 | LIPID MAPS |