EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H32O8 |
| Net Charge | 0 |
| Average Mass | 448.512 |
| Monoisotopic Mass | 448.20972 |
| SMILES | C[C@]12CCC3c4ccc(O)cc4CCC3C1CC[C@@H]2O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C24H32O8/c1-24-9-8-14-13-5-3-12(25)10-11(13)2-4-15(14)16(24)6-7-17(24)31-23-20(28)18(26)19(27)21(32-23)22(29)30/h3,5,10,14-21,23,25-28H,2,4,6-9H2,1H3,(H,29,30)/t14?,15?,16?,17-,18-,19-,20+,21-,23+,24-/m0/s1 |
| InChIKey | MTKNDAQYHASLID-RNFKDHMMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cannabis sativa (ncbitaxon:3483) | inflorescence (BTO:0000628) | MetaboLights (MTBLS6032) | Strain: Cannabis sativa var. DMG265 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17-beta-Estradiol glucuronide (CHEBI:197210) is a steroid saponin (CHEBI:61655) |
| IUPAC Name |
|---|
| (2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[[(13S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]oxy]oxane-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 59797 | ChemSpider |
| HMDB0010317 | HMDB |
| LMST05050028 | LIPID MAPS |