EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H34O5 |
| Net Charge | 0 |
| Average Mass | 378.509 |
| Monoisotopic Mass | 378.24062 |
| SMILES | CC/C=C\CC(O)/C=C/C1C(O)CC(O)C1C/C=C\C/C=C\CCC(=O)O |
| InChI | InChI=1S/C22H34O5/c1-2-3-8-11-17(23)14-15-19-18(20(24)16-21(19)25)12-9-6-4-5-7-10-13-22(26)27/h3,5-9,14-15,17-21,23-25H,2,4,10-13,16H2,1H3,(H,26,27)/b7-5-,8-3-,9-6-,15-14+ |
| InChIKey | DSZPTRJZWQQVFK-HOGCIABESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cannabis sativa (ncbitaxon:3483) | inflorescence (BTO:0000628) | MetaboLights (MTBLS6032) | Strain: Cannabis sativa var. DMG265 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17-F4-NeuroP (CHEBI:197143) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (4Z,7Z)-9-[3,5-dihydroxy-2-[(1E,5Z)-3-hydroxyocta-1,5-dienyl]cyclopentyl]nona-4,7-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 113386098 | ChemSpider |
| LMFA04010002 | LIPID MAPS |