EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H31F3N8O |
| Net Charge | 0 |
| Average Mass | 576.627 |
| Monoisotopic Mass | 576.25729 |
| SMILES | Cc1ccc(NC(=O)c2ccc(CN3CC[C@H](N(C)C)C3)c(C(F)(F)F)c2)cc1Nc1nccc(-c2cncnc2)n1 |
| InChI | InChI=1S/C30H31F3N8O/c1-19-4-7-23(13-27(19)39-29-36-10-8-26(38-29)22-14-34-18-35-15-22)37-28(42)20-5-6-21(25(12-20)30(31,32)33)16-41-11-9-24(17-41)40(2)3/h4-8,10,12-15,18,24H,9,11,16-17H2,1-3H3,(H,37,42)(H,36,38,39)/t24-/m0/s1 |
| InChIKey | ZGBAJMQHJDFTQJ-DEOSSOPVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cannabis sativa (ncbitaxon:3483) | inflorescence (BTO:0000628) | MetaboLights (MTBLS6032) | Strain: Cannabis sativa var. DMG265 |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Bafetinib (CHEBI:197107) has role antineoplastic agent (CHEBI:35610) |
| Bafetinib (CHEBI:197107) is a biaryl (CHEBI:64459) |
| IUPAC Name |
|---|
| 4-[[(3S)-3-(dimethylamino)pyrrolidin-1-yl]methyl]-N-[4-methyl-3-[(4-pyrimidin-5-ylpyrimidin-2-yl)amino]phenyl]-3-(triluoromethyl)benzamide |
| INN | Source |
|---|---|
| bafetinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| CNS-9 | ChEMBL |
| INNO-406 | ChEMBL |
| NS-187 | ChEMBL |
| Citations |
|---|