EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:197104 - 5(S),6(R)-Lipoxin A4 methyl ester
| Formula | C21H34O5 |
| Net Charge | 0 |
| Average Mass | 366.498 |
| Monoisotopic Mass | 366.24062 |
| SMILES | CCCCC[C@H](O)/C=C/C=C\C=C\C=C\[C@@H](O)[C@@H](O)CCCC(=O)OC |
| InChI | InChI=1S/C21H34O5/c1-3-4-9-13-18(22)14-10-7-5-6-8-11-15-19(23)20(24)16-12-17-21(25)26-2/h5-8,10-11,14-15,18-20,22-24H,3-4,9,12-13,16-17H2,1-2H3/b7-5-,8-6+,14-10+,15-11+/t18-,19+,20-/m0/s1 |
| InChIKey | UBPCKDCSZPRQJP-QDCMSWGPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cannabis sativa (ncbitaxon:3483) | inflorescence (BTO:0000628) | MetaboLights (MTBLS6032) | Strain: Cannabis sativa var. DMG265 |
| Roles Classification |
|---|
| Biological Role: | specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| Application: | specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5(S),6(R)-Lipoxin A4 methyl ester (CHEBI:197104) is a lipoxin (CHEBI:6497) |
| IUPAC Name |
|---|
| methyl (5S,6R,7E,9E,11Z,13E,15S)-5,6,15-trihydroxyicosa-7,9,11,13-tetraenoate |
| Manual Xrefs | Databases |
|---|---|
| 8144766 | ChemSpider |