EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16O5 |
| Net Charge | 0 |
| Average Mass | 240.255 |
| Monoisotopic Mass | 240.09977 |
| SMILES | Cc1c(CCC(=O)O)oc(CCC(=O)O)c1C |
| InChI | InChI=1S/C12H16O5/c1-7-8(2)10(4-6-12(15)16)17-9(7)3-5-11(13)14/h3-6H2,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | KRGCZCCLCZHGNO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cannabis sativa (ncbitaxon:3483) | inflorescence (BTO:0000628) | MetaboLights (MTBLS6032) | Strain: Cannabis sativa var. DMG265 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-dimethyl-5-carboxyethyl-2-furanpropanoic acid (CHEBI:197102) is a heterocyclic fatty acid (CHEBI:48847) |
| IUPAC Name |
|---|
| 3-[5-(2-carboxyethyl)-3,4-dimethyluran-2-yl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 113368392 | ChemSpider |
| LMFA01150050 | LIPID MAPS |