EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24O3 |
| Net Charge | 0 |
| Average Mass | 288.387 |
| Monoisotopic Mass | 288.17254 |
| SMILES | C=CCCCCC#CC#CC(=O)CCCCCCC(=O)O |
| InChI | InChI=1S/C18H24O3/c1-2-3-4-5-6-7-8-11-14-17(19)15-12-9-10-13-16-18(20)21/h2H,1,3-6,9-10,12-13,15-16H2,(H,20,21) |
| InChIKey | SSLASXCMMXZERF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cannabis sativa (ncbitaxon:3483) | inflorescence (BTO:0000628) | MetaboLights (MTBLS6032) | Strain: Cannabis sativa var. DMG265 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ketoisanic acid (CHEBI:197078) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| 8-oxooctadec-17-en-9,11-diynoic acid |
| Manual Xrefs | Databases |
|---|---|
| 57514446 | ChemSpider |
| LMFA01060211 | LIPID MAPS |