EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H34O4 |
| Net Charge | 0 |
| Average Mass | 386.532 |
| Monoisotopic Mass | 386.24571 |
| SMILES | [H][C@]12CC[C@@]3([H])C4=CC[C@]([H])([C@H](C)CCC(=O)O)[C@@]4(C)C(=O)C[C@]3([H])[C@@]1(C)CCC(=O)C2 |
| InChI | InChI=1S/C24H34O4/c1-14(4-9-22(27)28)18-7-8-19-17-6-5-15-12-16(25)10-11-23(15,2)20(17)13-21(26)24(18,19)3/h8,14-15,17-18,20H,4-7,9-13H2,1-3H3,(H,27,28)/t14-,15-,17+,18-,20+,23+,24-/m1/s1 |
| InChIKey | YRVLVRGBVUBNJV-BPCQACFLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cannabis sativa (ncbitaxon:3483) | inflorescence (BTO:0000628) | MetaboLights (MTBLS6032) | Strain: Cannabis sativa var. DMG265 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,12-Dioxo-5beta-chol-14-en-24-oic Acid (CHEBI:197071) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| (4R)-4-[(5R,8R,9S,10S,13R,17R)-10,13-dimethyl-3,12-dioxo-2,4,5,6,7,8,9,11,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4447136 | ChemSpider |
| LMST04010295 | LIPID MAPS |