EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32O6 |
| Net Charge | 0 |
| Average Mass | 392.492 |
| Monoisotopic Mass | 392.21989 |
| SMILES | CC/C=C\C/C=C\C/C=C/C=C/C1CC(C(C/C=C\CCC(=O)O)OO)OO1 |
| InChI | InChI=1S/C22H32O6/c1-2-3-4-5-6-7-8-9-10-12-15-19-18-21(28-27-19)20(26-25)16-13-11-14-17-22(23)24/h3-4,6-7,9-13,15,19-21,25H,2,5,8,14,16-18H2,1H3,(H,23,24)/b4-3-,7-6-,10-9+,13-11-,15-12+ |
| InChIKey | OIPKWLXLRXRCOU-MJWAYRHDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cannabis sativa (ncbitaxon:3483) | inflorescence (BTO:0000628) | MetaboLights (MTBLS6032) | Strain: Cannabis sativa var. DMG265 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (Z)-7-(5-((1E,3E,6Z,9Z)-dodeca-1,3,6,9-tetraen-1-yl)-1,2-dioxolan-3-yl)-7-hydroperoxyhept-4-enoic acid (CHEBI:197049) is a hydroperoxy fatty acid (CHEBI:64009) |
| IUPAC Name |
|---|
| (Z)-7-[5-[(1E,3E,6Z,9Z)-dodeca-1,3,6,9-tetraenyl]dioxolan-3-yl]-7-hydroperoxyhept-4-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA04060001 | LIPID MAPS |