EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14N2O6 |
| Net Charge | 0 |
| Average Mass | 330.296 |
| Monoisotopic Mass | 330.08519 |
| SMILES | O=C(O)c1ccc(CO/N=N/OCc2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C16H14N2O6/c19-15(20)13-5-1-11(2-6-13)9-23-17-18-24-10-12-3-7-14(8-4-12)16(21)22/h1-8H,9-10H2,(H,19,20)(H,21,22)/b18-17+ |
| InChIKey | KNKCXZHPOIMNJH-ISLYRVAYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cannabis sativa (ncbitaxon:3483) | inflorescence (BTO:0000628) | MetaboLights (MTBLS6032) | Strain: Cannabis sativa var. DMG265 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SOTS-1 (CHEBI:196993) is a benzoic acids (CHEBI:22723) |
| IUPAC Name |
|---|
| 4-[[(E)-(4-carboxyphenyl)methoxydiazenyl]oxymethyl]benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 28467768 | ChemSpider |